About 9H-fluorene
9H-fluorene (PubChem CID 6853) has the molecular formula C13H10
and a molecular weight of 166.22 g/mol. Its IUPAC name is 9H-fluorene.
Molecular Properties
| Compound Name | 9H-fluorene |
| PubChem CID | 6853 |
| Molecular Formula | C13H10 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 9H-fluorene |
| SMILES | c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
| InChIKey | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene?
The IUPAC name of 9H-fluorene (CID 6853) is 9H-fluorene.
What is the SMILES notation for 9H-fluorene?
The canonical SMILES for 9H-fluorene is c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene?
The InChIKey is NIHNNTQXNPWCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2.
What are the key properties of 9H-fluorene?
9H-fluorene has a molecular weight of 166.22 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene is sourced from PubChem (CID 6853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).