About 1H-indene
1H-indene (PubChem CID 7219) has the molecular formula C9H8
and a molecular weight of 116.16 g/mol. Its IUPAC name is 1H-indene.
Molecular Properties
| Compound Name | 1H-indene |
| PubChem CID | 7219 |
| Molecular Formula | C9H8 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 1H-indene |
| SMILES | C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C9H8/c1-2-5-9-7-3-6-8(9)4-1/h1-6H,7H2 |
| InChIKey | YBYIRNPNPLQARY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene?
The IUPAC name of 1H-indene (CID 7219) is 1H-indene.
What is the SMILES notation for 1H-indene?
The canonical SMILES for 1H-indene is C1=Cc2ccccc2C1.
What is the InChIKey of 1H-indene?
The InChIKey is YBYIRNPNPLQARY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8/c1-2-5-9-7-3-6-8(9)4-1/h1-6H,7H2.
What are the key properties of 1H-indene?
1H-indene has a molecular weight of 116.16 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene is sourced from PubChem (CID 7219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).