About 1,2-dihydronaphthalene
1,2-dihydronaphthalene (PubChem CID 9938) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 1,2-dihydronaphthalene |
| PubChem CID | 9938 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 1,2-dihydronaphthalene |
| SMILES | C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| InChIKey | KEIFWROAQVVDBN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydronaphthalene?
The IUPAC name of 1,2-dihydronaphthalene (CID 9938) is 1,2-dihydronaphthalene.
What is the SMILES notation for 1,2-dihydronaphthalene?
The canonical SMILES for 1,2-dihydronaphthalene is C1=Cc2ccccc2CC1.
What is the InChIKey of 1,2-dihydronaphthalene?
The InChIKey is KEIFWROAQVVDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2.
What are the key properties of 1,2-dihydronaphthalene?
1,2-dihydronaphthalene has a molecular weight of 130.19 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydronaphthalene is sourced from PubChem (CID 9938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).