About 2-phenylethylbenzene
2-phenylethylbenzene (PubChem CID 7647) has the molecular formula C14H14
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-phenylethylbenzene.
Molecular Properties
| Compound Name | 2-phenylethylbenzene |
| PubChem CID | 7647 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-phenylethylbenzene |
| SMILES | c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | QWUWMCYKGHVNAV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethylbenzene?
The IUPAC name of 2-phenylethylbenzene (CID 7647) is 2-phenylethylbenzene.
What is the SMILES notation for 2-phenylethylbenzene?
The canonical SMILES for 2-phenylethylbenzene is c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of 2-phenylethylbenzene?
The InChIKey is QWUWMCYKGHVNAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10H,11-12H2.
What are the key properties of 2-phenylethylbenzene?
2-phenylethylbenzene has a molecular weight of 182.27 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethylbenzene is sourced from PubChem (CID 7647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).