C25H28F3NO — CID 59963145
2,2,2-trifluoro-N-[4-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]phenyl]acetamide (PubChem CID 59963145) has the molecular formula C25H28F3NO and a molecular weight of 415.50 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 59963145 |
| Molecular Formula | C25H28F3NO |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]phenyl]acetamide |
| SMILES | C/C(=C/c1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28F3NO/c1-16(18-7-9-19(10-8-18)29-22(30)25(26,27)28)14-17-6-11-20-21(15-17)24(4,5)13-12-23(20,2)3/h6-11,14-15H,12-13H2,1-5H3,(H,29,30)/b16-14- |
| InChIKey | BCTBMZDEHDIQDE-PEZBUJJGSA-N |
| XLogP | 7.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|