C23H25F2NO3 — CID 23075279
4-[[2,2-difluoro-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]amino]benzoic acid (PubChem CID 23075279) has the molecular formula C23H25F2NO3 and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[[2,2-difluoro-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2,2-difluoro-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23075279 |
| Molecular Formula | C23H25F2NO3 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[[2,2-difluoro-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]amino]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(F)(F)C(=O)Nc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C23H25F2NO3/c1-21(2)11-12-22(3,4)18-13-15(7-10-17(18)21)23(24,25)20(29)26-16-8-5-14(6-9-16)19(27)28/h5-10,13H,11-12H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | RULGTSIIAQTYBW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |