C23H26O3S — CID 57073423
4-[2-hydroxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanethioyl]benzoic acid (PubChem CID 57073423) has the molecular formula C23H26O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-[2-hydroxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanethioyl]benzoic acid.
| Compound Name | 4-[2-hydroxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanethioyl]benzoic acid |
|---|---|
| PubChem CID | 57073423 |
| Molecular Formula | C23H26O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-[2-hydroxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethanethioyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(O)C(=S)c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C23H26O3S/c1-22(2)11-12-23(3,4)18-13-16(9-10-17(18)22)19(24)20(27)14-5-7-15(8-6-14)21(25)26/h5-10,13,19,24H,11-12H2,1-4H3,(H,25,26) |
| InChIKey | HEURCWVALYWVQN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|