C24H24O3 — CID 22619432
4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyl]benzoic acid (PubChem CID 22619432) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyl]benzoic acid.
| Compound Name | 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyl]benzoic acid |
|---|---|
| PubChem CID | 22619432 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-ynoyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C#CC(=O)c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C24H24O3/c1-23(2)13-14-24(3,4)20-15-16(5-11-19(20)23)6-12-21(25)17-7-9-18(10-8-17)22(26)27/h5,7-11,15H,13-14H2,1-4H3,(H,26,27) |
| InChIKey | FULWBRQCDVJNQS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|