C24H26O4S — CID 22641086
methyl 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynylsulfonyl]benzoate (PubChem CID 22641086) has the molecular formula C24H26O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is methyl 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynylsulfonyl]benzoate.
| Compound Name | methyl 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynylsulfonyl]benzoate |
|---|---|
| PubChem CID | 22641086 |
| Molecular Formula | C24H26O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynylsulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)C#Cc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H26O4S/c1-23(2)13-14-24(3,4)21-16-17(6-11-20(21)23)12-15-29(26,27)19-9-7-18(8-10-19)22(25)28-5/h6-11,16H,13-14H2,1-5H3 |
| InChIKey | AVNUORXOTAQGBM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|