C36H24O6 — CID 67068299
methyl 4-[2-[3,5-bis[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate (PubChem CID 67068299) has the molecular formula C36H24O6 and a molecular weight of 552.58 g/mol. Its IUPAC name is methyl 4-[2-[3,5-bis[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[3,5-bis[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 67068299 |
| Molecular Formula | C36H24O6 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | methyl 4-[2-[3,5-bis[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cc(C#Cc3ccc(C(=O)OC)cc3)cc(C#Cc3ccc(C(=O)OC)cc3)c2)cc1 |
| InChI | InChI=1S/C36H24O6/c1-40-34(37)31-16-10-25(11-17-31)4-7-28-22-29(8-5-26-12-18-32(19-13-26)35(38)41-2)24-30(23-28)9-6-27-14-20-33(21-15-27)36(39)42-3/h10-24H,1-3H3 |
| InChIKey | NELTYGFCXYARFG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|