C21H24O2Si2 — CID 66560271
methyl 4-[2-(1,1,3,3-tetramethyl-2H-1,3-benzodisilol-5-yl)ethynyl]benzoate (PubChem CID 66560271) has the molecular formula C21H24O2Si2 and a molecular weight of 364.59 g/mol. Its IUPAC name is methyl 4-[2-(1,1,3,3-tetramethyl-2H-1,3-benzodisilol-5-yl)ethynyl]benzoate.
| Compound Name | methyl 4-[2-(1,1,3,3-tetramethyl-2H-1,3-benzodisilol-5-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 66560271 |
| Molecular Formula | C21H24O2Si2 |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | methyl 4-[2-(1,1,3,3-tetramethyl-2H-1,3-benzodisilol-5-yl)ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc3c(c2)[Si](C)(C)C[Si]3(C)C)cc1 |
| InChI | InChI=1S/C21H24O2Si2/c1-23-21(22)18-11-8-16(9-12-18)6-7-17-10-13-19-20(14-17)25(4,5)15-24(19,2)3/h8-14H,15H2,1-5H3 |
| InChIKey | PBQVBPIGYLKUER-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|