C26H20O6 — CID 172869673
methyl 4-[2-[3-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]phenyl]ethynyl]benzoate (PubChem CID 172869673) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is methyl 4-[2-[3-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[3-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 172869673 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | methyl 4-[2-[3-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cccc(C(=O)C(=O)c3ccc(OC)c(OC)c3)c2)cc1 |
| InChI | InChI=1S/C26H20O6/c1-30-22-14-13-21(16-23(22)31-2)25(28)24(27)20-6-4-5-18(15-20)8-7-17-9-11-19(12-10-17)26(29)32-3/h4-6,9-16H,1-3H3 |
| InChIKey | OZQPOXSKFCIPPA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|