C28H24O8 — CID 172869711
methyl 4-[2-[2-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]ethynyl]benzoate (PubChem CID 172869711) has the molecular formula C28H24O8 and a molecular weight of 488.49 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[2-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 172869711 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | methyl 4-[2-[2-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cc(OC)c(OC)cc2C(=O)C(=O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C28H24O8/c1-32-21-12-20(13-22(15-21)33-2)26(29)27(30)23-16-25(35-4)24(34-3)14-19(23)11-8-17-6-9-18(10-7-17)28(31)36-5/h6-7,9-10,12-16H,1-5H3 |
| InChIKey | MKQGSTQPBVTGNZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|