C27H26O7 — CID 172869617
methyl 4-[2-[3-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-5-methoxyphenyl]ethyl]benzoate (PubChem CID 172869617) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl 4-[2-[3-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-5-methoxyphenyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[3-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-5-methoxyphenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 172869617 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | methyl 4-[2-[3-[2-(3,5-dimethoxyphenyl)-2-oxoacetyl]-5-methoxyphenyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2cc(OC)cc(C(=O)C(=O)c3cc(OC)cc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C27H26O7/c1-31-22-12-18(6-5-17-7-9-19(10-8-17)27(30)34-4)11-20(13-22)25(28)26(29)21-14-23(32-2)16-24(15-21)33-3/h7-16H,5-6H2,1-4H3 |
| InChIKey | XKRXJYPZIUCMGP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|