C24H26N2O4 — CID 175639771
methyl 4-[2-[6-[2-(3,5-dimethoxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoate (PubChem CID 175639771) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 4-[2-[6-[2-(3,5-dimethoxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[6-[2-(3,5-dimethoxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 175639771 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl 4-[2-[6-[2-(3,5-dimethoxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2cncc(CCc3cc(OC)cc(OC)c3)n2)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-28-22-12-18(13-23(14-22)29-2)7-11-21-16-25-15-20(26-21)10-6-17-4-8-19(9-5-17)24(27)30-3/h4-5,8-9,12-16H,6-7,10-11H2,1-3H3 |
| InChIKey | WVUPHFYVFAEAPB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |