C27H28O7 — CID 172869778
1-(3,5-dimethoxyphenyl)-2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxyphenyl]ethane-1,2-dione (PubChem CID 172869778) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxyphenyl]ethane-1,2-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxyphenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 172869778 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-[3-[2-(3,4-dimethoxyphenyl)ethyl]-5-methoxyphenyl]ethane-1,2-dione |
| SMILES | COc1cc(CCc2ccc(OC)c(OC)c2)cc(C(=O)C(=O)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C27H28O7/c1-30-21-11-18(7-6-17-8-9-24(33-4)25(12-17)34-5)10-19(13-21)26(28)27(29)20-14-22(31-2)16-23(15-20)32-3/h8-16H,6-7H2,1-5H3 |
| InChIKey | ZEKVXMLJRSXNDE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|