C26H28O5 — CID 171715332
4-[2-[4-[2-(3,5-dimethoxyphenyl)ethyl]phenyl]ethyl]-2-methoxybenzoic acid (PubChem CID 171715332) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[2-[4-[2-(3,5-dimethoxyphenyl)ethyl]phenyl]ethyl]-2-methoxybenzoic acid.
| Compound Name | 4-[2-[4-[2-(3,5-dimethoxyphenyl)ethyl]phenyl]ethyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 171715332 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-[2-[4-[2-(3,5-dimethoxyphenyl)ethyl]phenyl]ethyl]-2-methoxybenzoic acid |
| SMILES | COc1cc(CCc2ccc(CCc3ccc(C(=O)O)c(OC)c3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C26H28O5/c1-29-22-14-21(15-23(17-22)30-2)11-9-19-6-4-18(5-7-19)8-10-20-12-13-24(26(27)28)25(16-20)31-3/h4-7,12-17H,8-11H2,1-3H3,(H,27,28) |
| InChIKey | IRSQOXZYXIDAMM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |