C25H24O5 — CID 171715372
4-[2-[3-[2-(4-carboxyphenyl)ethyl]-5-methoxyphenyl]ethyl]benzoic acid (PubChem CID 171715372) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-carboxyphenyl)ethyl]-5-methoxyphenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[3-[2-(4-carboxyphenyl)ethyl]-5-methoxyphenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 171715372 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-[2-[3-[2-(4-carboxyphenyl)ethyl]-5-methoxyphenyl]ethyl]benzoic acid |
| SMILES | COc1cc(CCc2ccc(C(=O)O)cc2)cc(CCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H24O5/c1-30-23-15-19(4-2-17-6-10-21(11-7-17)24(26)27)14-20(16-23)5-3-18-8-12-22(13-9-18)25(28)29/h6-16H,2-5H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | FFDKMRKIGRFORA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |