C17H16O5 — CID 174499523
5-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 174499523) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174499523 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccc(CCc2cc(C(=O)O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H16O5/c1-22-15-6-4-11(5-7-15)2-3-12-8-13(16(18)19)10-14(9-12)17(20)21/h4-10H,2-3H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | IZNKHPYYZSPBDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |