C16H14N2O5 — CID 90925844
5-[(4-methoxyphenyl)methyldiazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 90925844) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyldiazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(4-methoxyphenyl)methyldiazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 90925844 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyldiazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccc(C/N=N/c2cc(C(=O)O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H14N2O5/c1-23-14-4-2-10(3-5-14)9-17-18-13-7-11(15(19)20)6-12(8-13)16(21)22/h2-8H,9H2,1H3,(H,19,20)(H,21,22)/b18-17+ |
| InChIKey | JDDSYCPUIQPPID-ISLYRVAYSA-N |
| XLogP | 3.38 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|