C26H26O7 — CID 100977518
5-[5-[4-(4-methoxyphenyl)phenoxy]pentoxy]benzene-1,3-dicarboxylic acid (PubChem CID 100977518) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is 5-[5-[4-(4-methoxyphenyl)phenoxy]pentoxy]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[4-(4-methoxyphenyl)phenoxy]pentoxy]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 100977518 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 5-[5-[4-(4-methoxyphenyl)phenoxy]pentoxy]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccc(-c2ccc(OCCCCCOc3cc(C(=O)O)cc(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C26H26O7/c1-31-22-9-5-18(6-10-22)19-7-11-23(12-8-19)32-13-3-2-4-14-33-24-16-20(25(27)28)15-21(17-24)26(29)30/h5-12,15-17H,2-4,13-14H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | XAPBSXLUYWACDN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|