About ethane;4-octoxybenzoic acid
ethane;4-octoxybenzoic acid (PubChem CID 144740890) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;4-octoxybenzoic acid.
Molecular Properties
| Compound Name | ethane;4-octoxybenzoic acid |
| PubChem CID | 144740890 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethane;4-octoxybenzoic acid |
| SMILES | CC.CCCCCCCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H22O3.C2H6/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17;1-2/h8-11H,2-7,12H2,1H3,(H,16,17);1-2H3 |
| InChIKey | XEZDQGNTJHPXDQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-octoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-octoxybenzoic acid?
The IUPAC name of ethane;4-octoxybenzoic acid (CID 144740890) is ethane;4-octoxybenzoic acid.
What is the SMILES notation for ethane;4-octoxybenzoic acid?
The canonical SMILES for ethane;4-octoxybenzoic acid is CC.CCCCCCCCOc1ccc(C(=O)O)cc1.
What is the InChIKey of ethane;4-octoxybenzoic acid?
The InChIKey is XEZDQGNTJHPXDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3.C2H6/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17;1-2/h8-11H,2-7,12H2,1H3,(H,16,17);1-2H3.
What are the key properties of ethane;4-octoxybenzoic acid?
ethane;4-octoxybenzoic acid has a molecular weight of 280.41 g/mol, XLogP of 5.15, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-octoxybenzoic acid is sourced from PubChem (CID 144740890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).