About methyl propanoate;4-pentoxybenzoic acid
methyl propanoate;4-pentoxybenzoic acid (PubChem CID 142016787) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl propanoate;4-pentoxybenzoic acid.
Molecular Properties
| Compound Name | methyl propanoate;4-pentoxybenzoic acid |
| PubChem CID | 142016787 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl propanoate;4-pentoxybenzoic acid |
| SMILES | CCC(=O)OC.CCCCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H16O3.C4H8O2/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14;1-3-4(5)6-2/h5-8H,2-4,9H2,1H3,(H,13,14);3H2,1-2H3 |
| InChIKey | KVWBIDAXWZUTBZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl propanoate;4-pentoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl propanoate;4-pentoxybenzoic acid?
The IUPAC name of methyl propanoate;4-pentoxybenzoic acid (CID 142016787) is methyl propanoate;4-pentoxybenzoic acid.
What is the SMILES notation for methyl propanoate;4-pentoxybenzoic acid?
The canonical SMILES for methyl propanoate;4-pentoxybenzoic acid is CCC(=O)OC.CCCCCOc1ccc(C(=O)O)cc1.
What is the InChIKey of methyl propanoate;4-pentoxybenzoic acid?
The InChIKey is KVWBIDAXWZUTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3.C4H8O2/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14;1-3-4(5)6-2/h5-8H,2-4,9H2,1H3,(H,13,14);3H2,1-2H3.
What are the key properties of methyl propanoate;4-pentoxybenzoic acid?
methyl propanoate;4-pentoxybenzoic acid has a molecular weight of 296.36 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl propanoate;4-pentoxybenzoic acid is sourced from PubChem (CID 142016787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).