C24H32O4 — CID 22983350
6-[4-(4-methoxyphenyl)phenoxy]hexyl 2-methylbutanoate (PubChem CID 22983350) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)phenoxy]hexyl 2-methylbutanoate.
| Compound Name | 6-[4-(4-methoxyphenyl)phenoxy]hexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 22983350 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)phenoxy]hexyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCOc1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H32O4/c1-4-19(2)24(25)28-18-8-6-5-7-17-27-23-15-11-21(12-16-23)20-9-13-22(26-3)14-10-20/h9-16,19H,4-8,17-18H2,1-3H3 |
| InChIKey | XLHLIHYIIAOCDU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|