C25H31NO4 — CID 59887041
6-[4-[4-(methylideneamino)benzoyl]phenoxy]hexyl 2-methylbutanoate (PubChem CID 59887041) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 6-[4-[4-(methylideneamino)benzoyl]phenoxy]hexyl 2-methylbutanoate.
| Compound Name | 6-[4-[4-(methylideneamino)benzoyl]phenoxy]hexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59887041 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 6-[4-[4-(methylideneamino)benzoyl]phenoxy]hexyl 2-methylbutanoate |
| SMILES | C=Nc1ccc(C(=O)c2ccc(OCCCCCCOC(=O)C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-4-19(2)25(28)30-18-8-6-5-7-17-29-23-15-11-21(12-16-23)24(27)20-9-13-22(26-3)14-10-20/h9-16,19H,3-8,17-18H2,1-2H3 |
| InChIKey | NNUXNNHTMBNHPV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|