C38H46O10 — CID 129085877
[3-methyl-4-[4-[4-(2-methylbutanoyloxy)butoxy]benzoyl]oxyphenyl] 4-[4-(2-methylpropanoyloxy)butoxy]benzoate (PubChem CID 129085877) has the molecular formula C38H46O10 and a molecular weight of 662.78 g/mol. Its IUPAC name is [3-methyl-4-[4-[4-(2-methylbutanoyloxy)butoxy]benzoyl]oxyphenyl] 4-[4-(2-methylpropanoyloxy)butoxy]benzoate.
| Compound Name | [3-methyl-4-[4-[4-(2-methylbutanoyloxy)butoxy]benzoyl]oxyphenyl] 4-[4-(2-methylpropanoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 129085877 |
| Molecular Formula | C38H46O10 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | [3-methyl-4-[4-[4-(2-methylbutanoyloxy)butoxy]benzoyl]oxyphenyl] 4-[4-(2-methylpropanoyloxy)butoxy]benzoate |
| SMILES | CCC(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCOC(=O)C(C)C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C38H46O10/c1-6-27(4)36(40)46-24-10-8-22-44-32-17-13-30(14-18-32)38(42)48-34-20-19-33(25-28(34)5)47-37(41)29-11-15-31(16-12-29)43-21-7-9-23-45-35(39)26(2)3/h11-20,25-27H,6-10,21-24H2,1-5H3 |
| InChIKey | BDVHJYSALIGFDQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|