C33H36O10 — CID 174110547
[3-methyl-4-[4-(2-methylbutanoyloxymethoxy)benzoyl]oxyphenyl] 4-(2-methylbutanoyloxymethoxy)benzoate (PubChem CID 174110547) has the molecular formula C33H36O10 and a molecular weight of 592.64 g/mol. Its IUPAC name is [3-methyl-4-[4-(2-methylbutanoyloxymethoxy)benzoyl]oxyphenyl] 4-(2-methylbutanoyloxymethoxy)benzoate.
| Compound Name | [3-methyl-4-[4-(2-methylbutanoyloxymethoxy)benzoyl]oxyphenyl] 4-(2-methylbutanoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 174110547 |
| Molecular Formula | C33H36O10 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | [3-methyl-4-[4-(2-methylbutanoyloxymethoxy)benzoyl]oxyphenyl] 4-(2-methylbutanoyloxymethoxy)benzoate |
| SMILES | CCC(C)C(=O)OCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCOC(=O)C(C)CC)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C33H36O10/c1-6-21(3)30(34)40-19-38-26-12-8-24(9-13-26)32(36)42-28-16-17-29(23(5)18-28)43-33(37)25-10-14-27(15-11-25)39-20-41-31(35)22(4)7-2/h8-18,21-22H,6-7,19-20H2,1-5H3 |
| InChIKey | GEGOWNWDJFWUSH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|