C23H20O6S2 — CID 170539195
[3-methyl-4-[4-(sulfanylmethoxy)benzoyl]oxyphenyl] 4-(sulfanylmethoxy)benzoate (PubChem CID 170539195) has the molecular formula C23H20O6S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is [3-methyl-4-[4-(sulfanylmethoxy)benzoyl]oxyphenyl] 4-(sulfanylmethoxy)benzoate.
| Compound Name | [3-methyl-4-[4-(sulfanylmethoxy)benzoyl]oxyphenyl] 4-(sulfanylmethoxy)benzoate |
|---|---|
| PubChem CID | 170539195 |
| Molecular Formula | C23H20O6S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [3-methyl-4-[4-(sulfanylmethoxy)benzoyl]oxyphenyl] 4-(sulfanylmethoxy)benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(OCS)cc2)ccc1OC(=O)c1ccc(OCS)cc1 |
| InChI | InChI=1S/C23H20O6S2/c1-15-12-20(28-22(24)16-2-6-18(7-3-16)26-13-30)10-11-21(15)29-23(25)17-4-8-19(9-5-17)27-14-31/h2-12,30-31H,13-14H2,1H3 |
| InChIKey | HOHHJRPGPXVIRG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|