C39H48N4O6 — CID 144914311
[4-[4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoyl]oxy-3-methylphenyl] 4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoate (PubChem CID 144914311) has the molecular formula C39H48N4O6 and a molecular weight of 668.84 g/mol. Its IUPAC name is [4-[4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoyl]oxy-3-methylphenyl] 4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoate.
| Compound Name | [4-[4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoyl]oxy-3-methylphenyl] 4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoate |
|---|---|
| PubChem CID | 144914311 |
| Molecular Formula | C39H48N4O6 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | [4-[4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoyl]oxy-3-methylphenyl] 4-[6-(1-aminoprop-2-enylideneamino)hexoxy]benzoate |
| SMILES | C=C/C(N)=N\CCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCC/N=C(/N)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C39H48N4O6/c1-4-36(40)42-24-10-6-8-12-26-46-32-18-14-30(15-19-32)38(44)48-34-22-23-35(29(3)28-34)49-39(45)31-16-20-33(21-17-31)47-27-13-9-7-11-25-43-37(41)5-2/h4-5,14-23,28H,1-2,6-13,24-27H2,3H3,(H2,40,42)(H2,41,43) |
| InChIKey | IWCYVQIPUXRSQL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|