C47H76O8Si4 — CID 100914819
[4-[4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoyl]oxy-3-methylphenyl] 4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoate (PubChem CID 100914819) has the molecular formula C47H76O8Si4 and a molecular weight of 881.46 g/mol. Its IUPAC name is [4-[4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoyl]oxy-3-methylphenyl] 4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoate.
| Compound Name | [4-[4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoyl]oxy-3-methylphenyl] 4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoate |
|---|---|
| PubChem CID | 100914819 |
| Molecular Formula | C47H76O8Si4 |
| Molecular Weight | 881.46 g/mol |
| Exact Mass | 880.46 |
| IUPAC Name | [4-[4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoyl]oxy-3-methylphenyl] 4-[8-[dimethyl(trimethylsilyloxy)silyl]octoxy]benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(OCCCCCCCC[Si](C)(C)O[Si](C)(C)C)cc2)ccc1OC(=O)c1ccc(OCCCCCCCC[Si](C)(C)O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C47H76O8Si4/c1-39-38-44(52-46(48)40-24-28-42(29-25-40)50-34-20-16-12-14-18-22-36-58(8,9)54-56(2,3)4)32-33-45(39)53-47(49)41-26-30-43(31-27-41)51-35-21-17-13-15-19-23-37-59(10,11)55-57(5,6)7/h24-33,38H,12-23,34-37H2,1-11H3 |
| InChIKey | OUXZNMVUGBYNNU-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.46 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|