About (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate
(4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate (PubChem CID 19104486) has the molecular formula C28H44O5Si2
and a molecular weight of 516.83 g/mol. Its IUPAC name is (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate.
Molecular Properties
| Compound Name | (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate |
| PubChem CID | 19104486 |
| Molecular Formula | C28H44O5Si2 |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate |
| SMILES | CCCCOc1ccc(OC(=O)c2ccc(OCCCCCC[Si](C)(C)O[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H44O5Si2/c1-7-8-21-30-26-17-19-27(20-18-26)32-28(29)24-13-15-25(16-14-24)31-22-11-9-10-12-23-35(5,6)33-34(2,3)4/h13-20H,7-12,21-23H2,1-6H3 |
| InChIKey | HHJOYVJOLCXDFS-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate?
The IUPAC name of (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate (CID 19104486) is (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate.
What is the SMILES notation for (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate?
The canonical SMILES for (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate is CCCCOc1ccc(OC(=O)c2ccc(OCCCCCC[Si](C)(C)O[Si](C)(C)C)cc2)cc1.
What is the InChIKey of (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate?
The InChIKey is HHJOYVJOLCXDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44O5Si2/c1-7-8-21-30-26-17-19-27(20-18-26)32-28(29)24-13-15-25(16-14-24)31-22-11-9-10-12-23-35(5,6)33-34(2,3)4/h13-20H,7-12,21-23H2,1-6H3.
What are the key properties of (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate?
(4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate has a molecular weight of 516.83 g/mol, XLogP of 8.08, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxyphenyl) 4-[6-[dimethyl(trimethylsilyloxy)silyl]hexoxy]benzoate is sourced from PubChem (CID 19104486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).