C35H36O10 — CID 67775997
[4-[4-(4-hydroxy-5-oxohept-6-enoxy)benzoyl]oxy-3-methylphenyl] 4-(4-hydroxy-5-oxohept-6-enoxy)benzoate (PubChem CID 67775997) has the molecular formula C35H36O10 and a molecular weight of 616.66 g/mol. Its IUPAC name is [4-[4-(4-hydroxy-5-oxohept-6-enoxy)benzoyl]oxy-3-methylphenyl] 4-(4-hydroxy-5-oxohept-6-enoxy)benzoate.
| Compound Name | [4-[4-(4-hydroxy-5-oxohept-6-enoxy)benzoyl]oxy-3-methylphenyl] 4-(4-hydroxy-5-oxohept-6-enoxy)benzoate |
|---|---|
| PubChem CID | 67775997 |
| Molecular Formula | C35H36O10 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | [4-[4-(4-hydroxy-5-oxohept-6-enoxy)benzoyl]oxy-3-methylphenyl] 4-(4-hydroxy-5-oxohept-6-enoxy)benzoate |
| SMILES | C=CC(=O)C(O)CCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCC(O)C(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C35H36O10/c1-4-29(36)31(38)8-6-20-42-26-14-10-24(11-15-26)34(40)44-28-18-19-33(23(3)22-28)45-35(41)25-12-16-27(17-13-25)43-21-7-9-32(39)30(37)5-2/h4-5,10-19,22,31-32,38-39H,1-2,6-9,20-21H2,3H3 |
| InChIKey | DQVIJRLOLUKOHH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|