C27H24O8 — CID 21138311
[3-methyl-4-[4-(oxiran-2-ylmethoxy)benzoyl]oxyphenyl] 4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 21138311) has the molecular formula C27H24O8 and a molecular weight of 476.48 g/mol. Its IUPAC name is [3-methyl-4-[4-(oxiran-2-ylmethoxy)benzoyl]oxyphenyl] 4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | [3-methyl-4-[4-(oxiran-2-ylmethoxy)benzoyl]oxyphenyl] 4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 21138311 |
| Molecular Formula | C27H24O8 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [3-methyl-4-[4-(oxiran-2-ylmethoxy)benzoyl]oxyphenyl] 4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(OCC3CO3)cc2)ccc1OC(=O)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C27H24O8/c1-17-12-22(34-26(28)18-2-6-20(7-3-18)30-13-23-15-32-23)10-11-25(17)35-27(29)19-4-8-21(9-5-19)31-14-24-16-33-24/h2-12,23-24H,13-16H2,1H3 |
| InChIKey | NFSJLJJGOSMFGM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|