C25H20O6 — CID 89353868
(7-formyloxy-9-methyl-9H-fluoren-2-yl) 4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 89353868) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is (7-formyloxy-9-methyl-9H-fluoren-2-yl) 4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | (7-formyloxy-9-methyl-9H-fluoren-2-yl) 4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 89353868 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (7-formyloxy-9-methyl-9H-fluoren-2-yl) 4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | CC1c2cc(OC=O)ccc2-c2ccc(OC(=O)c3ccc(OCC4CO4)cc3)cc21 |
| InChI | InChI=1S/C25H20O6/c1-15-23-10-18(30-14-26)6-8-21(23)22-9-7-19(11-24(15)22)31-25(27)16-2-4-17(5-3-16)28-12-20-13-29-20/h2-11,14-15,20H,12-13H2,1H3 |
| InChIKey | XKSFWOXBKLSGMP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|