C40H40O8 — CID 58776340
[9-methyl-7-[4-[4-(oxiran-2-yl)butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[4-(oxiran-2-yl)butoxy]benzoate (PubChem CID 58776340) has the molecular formula C40H40O8 and a molecular weight of 648.75 g/mol. Its IUPAC name is [9-methyl-7-[4-[4-(oxiran-2-yl)butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[4-(oxiran-2-yl)butoxy]benzoate.
| Compound Name | [9-methyl-7-[4-[4-(oxiran-2-yl)butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[4-(oxiran-2-yl)butoxy]benzoate |
|---|---|
| PubChem CID | 58776340 |
| Molecular Formula | C40H40O8 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | [9-methyl-7-[4-[4-(oxiran-2-yl)butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-[4-(oxiran-2-yl)butoxy]benzoate |
| SMILES | CC1c2cc(OC(=O)c3ccc(OCCCCC4CO4)cc3)ccc2-c2ccc(OC(=O)c3ccc(OCCCCC4CO4)cc3)cc21 |
| InChI | InChI=1S/C40H40O8/c1-26-37-22-31(47-39(41)27-8-12-29(13-9-27)43-20-4-2-6-33-24-45-33)16-18-35(37)36-19-17-32(23-38(26)36)48-40(42)28-10-14-30(15-11-28)44-21-5-3-7-34-25-46-34/h8-19,22-23,26,33-34H,2-7,20-21,24-25H2,1H3 |
| InChIKey | RXXZSNSXBNOEBP-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|