C46H54O8 — CID 58586889
[9-methyl-7-[4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-nonoxybenzoate (PubChem CID 58586889) has the molecular formula C46H54O8 and a molecular weight of 734.93 g/mol. Its IUPAC name is [9-methyl-7-[4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-nonoxybenzoate.
| Compound Name | [9-methyl-7-[4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-nonoxybenzoate |
|---|---|
| PubChem CID | 58586889 |
| Molecular Formula | C46H54O8 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.38 |
| IUPAC Name | [9-methyl-7-[4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-9H-fluoren-2-yl] 4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(OCCCCOCC5(C)COC5)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C46H54O8/c1-4-5-6-7-8-9-10-26-51-36-17-13-34(14-18-36)44(47)53-38-21-23-40-41-24-22-39(29-43(41)33(2)42(40)28-38)54-45(48)35-15-19-37(20-16-35)52-27-12-11-25-49-30-46(3)31-50-32-46/h13-24,28-29,33H,4-12,25-27,30-32H2,1-3H3 |
| InChIKey | VWGZNWWBQHDASN-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|