C34H37NO5 — CID 58586922
[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl] 7-isocyano-9-methyl-9H-fluorene-2-carboxylate (PubChem CID 58586922) has the molecular formula C34H37NO5 and a molecular weight of 539.67 g/mol. Its IUPAC name is [4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl] 7-isocyano-9-methyl-9H-fluorene-2-carboxylate.
| Compound Name | [4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl] 7-isocyano-9-methyl-9H-fluorene-2-carboxylate |
|---|---|
| PubChem CID | 58586922 |
| Molecular Formula | C34H37NO5 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | [4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl] 7-isocyano-9-methyl-9H-fluorene-2-carboxylate |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)c1cc(C(=O)Oc3ccc(OCCCCCCOCC4(CC)COC4)cc3)ccc1-2 |
| InChI | InChI=1S/C34H37NO5/c1-4-34(22-38-23-34)21-37-17-7-5-6-8-18-39-27-11-13-28(14-12-27)40-33(36)25-9-15-29-30-16-10-26(35-3)20-32(30)24(2)31(29)19-25/h9-16,19-20,24H,4-8,17-18,21-23H2,1-2H3 |
| InChIKey | FHOAGDATRZKJRN-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 58.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|