C39H41F3O4 — CID 71094060
3-ethyl-3-[6-[4-[9-methyl-7-[4-(trifluoromethoxy)phenyl]-9H-fluoren-2-yl]phenoxy]hexoxymethyl]oxetane (PubChem CID 71094060) has the molecular formula C39H41F3O4 and a molecular weight of 630.75 g/mol. Its IUPAC name is 3-ethyl-3-[6-[4-[9-methyl-7-[4-(trifluoromethoxy)phenyl]-9H-fluoren-2-yl]phenoxy]hexoxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[6-[4-[9-methyl-7-[4-(trifluoromethoxy)phenyl]-9H-fluoren-2-yl]phenoxy]hexoxymethyl]oxetane |
|---|---|
| PubChem CID | 71094060 |
| Molecular Formula | C39H41F3O4 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 3-ethyl-3-[6-[4-[9-methyl-7-[4-(trifluoromethoxy)phenyl]-9H-fluoren-2-yl]phenoxy]hexoxymethyl]oxetane |
| SMILES | CCC1(COCCCCCCOc2ccc(-c3ccc4c(c3)C(C)c3cc(-c5ccc(OC(F)(F)F)cc5)ccc3-4)cc2)COC1 |
| InChI | InChI=1S/C39H41F3O4/c1-3-38(25-44-26-38)24-43-20-6-4-5-7-21-45-32-14-8-28(9-15-32)30-12-18-34-35-19-13-31(23-37(35)27(2)36(34)22-30)29-10-16-33(17-11-29)46-39(40,41)42/h8-19,22-23,27H,3-7,20-21,24-26H2,1-2H3 |
| InChIKey | SJFWQRWVMSOKSP-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|