C33H37NO3 — CID 71094053
7-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]-9-methyl-9H-fluorene-2-carbonitrile (PubChem CID 71094053) has the molecular formula C33H37NO3 and a molecular weight of 495.66 g/mol. Its IUPAC name is 7-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]-9-methyl-9H-fluorene-2-carbonitrile.
| Compound Name | 7-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]-9-methyl-9H-fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 71094053 |
| Molecular Formula | C33H37NO3 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 7-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]-9-methyl-9H-fluorene-2-carbonitrile |
| SMILES | CCC1(COCCCCCCOc2ccc(-c3ccc4c(c3)C(C)c3cc(C#N)ccc3-4)cc2)COC1 |
| InChI | InChI=1S/C33H37NO3/c1-3-33(22-36-23-33)21-35-16-6-4-5-7-17-37-28-12-9-26(10-13-28)27-11-15-30-29-14-8-25(20-34)18-31(29)24(2)32(30)19-27/h8-15,18-19,24H,3-7,16-17,21-23H2,1-2H3 |
| InChIKey | RQYQEERPXZTSFV-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|