C37H60O7Si — CID 91076781
triethoxy-[3-[4-[4-[10-[(3-ethyloxetan-3-yl)methoxy]decoxy]phenyl]phenoxy]propyl]silane (PubChem CID 91076781) has the molecular formula C37H60O7Si and a molecular weight of 644.97 g/mol. Its IUPAC name is triethoxy-[3-[4-[4-[10-[(3-ethyloxetan-3-yl)methoxy]decoxy]phenyl]phenoxy]propyl]silane.
| Compound Name | triethoxy-[3-[4-[4-[10-[(3-ethyloxetan-3-yl)methoxy]decoxy]phenyl]phenoxy]propyl]silane |
|---|---|
| PubChem CID | 91076781 |
| Molecular Formula | C37H60O7Si |
| Molecular Weight | 644.97 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | triethoxy-[3-[4-[4-[10-[(3-ethyloxetan-3-yl)methoxy]decoxy]phenyl]phenoxy]propyl]silane |
| SMILES | CCO[Si](CCCOc1ccc(-c2ccc(OCCCCCCCCCCOCC3(CC)COC3)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C37H60O7Si/c1-5-37(31-39-32-37)30-38-26-15-13-11-9-10-12-14-16-27-40-35-22-18-33(19-23-35)34-20-24-36(25-21-34)41-28-17-29-45(42-6-2,43-7-3)44-8-4/h18-25H,5-17,26-32H2,1-4H3 |
| InChIKey | XGULAGJFWLIBDT-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.97 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|