C18H26O5 — CID 59197240
methyl 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate (PubChem CID 59197240) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate.
| Compound Name | methyl 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 59197240 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate |
| SMILES | CCC1(COCCCCOc2ccc(C(=O)OC)cc2)COC1 |
| InChI | InChI=1S/C18H26O5/c1-3-18(13-22-14-18)12-21-10-4-5-11-23-16-8-6-15(7-9-16)17(19)20-2/h6-9H,3-5,10-14H2,1-2H3 |
| InChIKey | PIGRBBWAHDFIQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|