C17H24O6 — CID 58090307
4-[2-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]ethoxy]benzoic acid (PubChem CID 58090307) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-[2-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 58090307 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[2-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]ethoxy]benzoic acid |
| SMILES | CCC1(COCCOCCOc2ccc(C(=O)O)cc2)COC1 |
| InChI | InChI=1S/C17H24O6/c1-2-17(12-22-13-17)11-21-8-7-20-9-10-23-15-5-3-14(4-6-15)16(18)19/h3-6H,2,7-13H2,1H3,(H,18,19) |
| InChIKey | ZTUSNONYOMWILR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|