C52H55F3O10 — CID 163605741
[4-[4-[4-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-3-fluorophenyl]-3-fluorophenyl]-2-fluorophenyl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate (PubChem CID 163605741) has the molecular formula C52H55F3O10 and a molecular weight of 897.00 g/mol. Its IUPAC name is [4-[4-[4-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-3-fluorophenyl]-3-fluorophenyl]-2-fluorophenyl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate.
| Compound Name | [4-[4-[4-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-3-fluorophenyl]-3-fluorophenyl]-2-fluorophenyl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 163605741 |
| Molecular Formula | C52H55F3O10 |
| Molecular Weight | 897.00 g/mol |
| Exact Mass | 896.37 |
| IUPAC Name | [4-[4-[4-[4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoyl]oxy-3-fluorophenyl]-3-fluorophenyl]-2-fluorophenyl] 4-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]benzoate |
| SMILES | CCC1(COCCCCOc2ccc(C(=O)Oc3ccc(-c4ccc(-c5ccc(OC(=O)c6ccc(OCCCCOCC7(CC)COC7)cc6)c(F)c5)c(F)c4)cc3F)cc2)COC1 |
| InChI | InChI=1S/C52H55F3O10/c1-3-51(32-60-33-51)30-58-23-5-7-25-62-41-16-9-36(10-17-41)49(56)64-47-21-14-39(28-45(47)54)38-13-20-43(44(53)27-38)40-15-22-48(46(55)29-40)65-50(57)37-11-18-42(19-12-37)63-26-8-6-24-59-31-52(4-2)34-61-35-52/h9-22,27-29H,3-8,23-26,30-35H2,1-2H3 |
| InChIKey | HBPPGWXBBUBSLU-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.00 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|