C28H34F4O6 — CID 59767519
[3-fluoro-4-(trifluoromethoxy)phenyl] 3-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]propanoate (PubChem CID 59767519) has the molecular formula C28H34F4O6 and a molecular weight of 542.57 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethoxy)phenyl] 3-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]propanoate.
| Compound Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 3-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 59767519 |
| Molecular Formula | C28H34F4O6 |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 3-[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexoxy]phenyl]propanoate |
| SMILES | CCC1(COCCCCCCOc2ccc(CCC(=O)Oc3ccc(OC(F)(F)F)c(F)c3)cc2)COC1 |
| InChI | InChI=1S/C28H34F4O6/c1-2-27(19-35-20-27)18-34-15-5-3-4-6-16-36-22-10-7-21(8-11-22)9-14-26(33)37-23-12-13-25(24(29)17-23)38-28(30,31)32/h7-8,10-13,17H,2-6,9,14-16,18-20H2,1H3 |
| InChIKey | SHEWBZMEAIVBIN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|