C27H32F4O6 — CID 59767552
[3-fluoro-4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate (PubChem CID 59767552) has the molecular formula C27H32F4O6 and a molecular weight of 528.54 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate.
| Compound Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate |
|---|---|
| PubChem CID | 59767552 |
| Molecular Formula | C27H32F4O6 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate |
| SMILES | CC1(COCCCCCCCCOc2ccc(C(=O)Oc3ccc(OC(F)(F)F)c(F)c3)cc2)COC1 |
| InChI | InChI=1S/C27H32F4O6/c1-26(18-34-19-26)17-33-14-6-4-2-3-5-7-15-35-21-10-8-20(9-11-21)25(32)36-22-12-13-24(23(28)16-22)37-27(29,30)31/h8-13,16H,2-7,14-15,17-19H2,1H3 |
| InChIKey | WPVNNVFOHYPOFL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|