C22H22F4O6 — CID 59767531
[3-fluoro-4-(trifluoromethoxy)phenyl] 4-[3-[(3-methyloxetan-3-yl)methoxy]propoxy]benzoate (PubChem CID 59767531) has the molecular formula C22H22F4O6 and a molecular weight of 458.40 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[3-[(3-methyloxetan-3-yl)methoxy]propoxy]benzoate.
| Compound Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[3-[(3-methyloxetan-3-yl)methoxy]propoxy]benzoate |
|---|---|
| PubChem CID | 59767531 |
| Molecular Formula | C22H22F4O6 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-[3-[(3-methyloxetan-3-yl)methoxy]propoxy]benzoate |
| SMILES | CC1(COCCCOc2ccc(C(=O)Oc3ccc(OC(F)(F)F)c(F)c3)cc2)COC1 |
| InChI | InChI=1S/C22H22F4O6/c1-21(13-29-14-21)12-28-9-2-10-30-16-5-3-15(4-6-16)20(27)31-17-7-8-19(18(23)11-17)32-22(24,25)26/h3-8,11H,2,9-10,12-14H2,1H3 |
| InChIKey | YCKAGRNQIATZKI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|