C23H25F3O6 — CID 59767559
[4-(trifluoromethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate (PubChem CID 59767559) has the molecular formula C23H25F3O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 59767559 |
| Molecular Formula | C23H25F3O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]benzoate |
| SMILES | CC1(COCCCCOc2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)COC1 |
| InChI | InChI=1S/C23H25F3O6/c1-22(15-29-16-22)14-28-12-2-3-13-30-18-6-4-17(5-7-18)21(27)31-19-8-10-20(11-9-19)32-23(24,25)26/h4-11H,2-3,12-16H2,1H3 |
| InChIKey | HEIDXFBXELGXQX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|