C21H18F6O5 — CID 59767555
[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl] 4-[(3-methyloxetan-3-yl)methoxy]benzoate (PubChem CID 59767555) has the molecular formula C21H18F6O5 and a molecular weight of 464.36 g/mol. Its IUPAC name is [4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl] 4-[(3-methyloxetan-3-yl)methoxy]benzoate.
| Compound Name | [4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl] 4-[(3-methyloxetan-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 59767555 |
| Molecular Formula | C21H18F6O5 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl] 4-[(3-methyloxetan-3-yl)methoxy]benzoate |
| SMILES | CC1(COc2ccc(C(=O)Oc3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)cc2)COC1 |
| InChI | InChI=1S/C21H18F6O5/c1-19(10-29-11-19)12-30-14-4-2-13(3-5-14)17(28)31-15-6-8-16(9-7-15)32-21(26,27)18(22)20(23,24)25/h2-9,18H,10-12H2,1H3 |
| InChIKey | GTOXEJWWBFGKTD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|