C20H19F3O5 — CID 59767520
[4-(trifluoromethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate (PubChem CID 59767520) has the molecular formula C20H19F3O5 and a molecular weight of 396.36 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 59767520 |
| Molecular Formula | C20H19F3O5 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
| SMILES | CCC1(COc2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)COC1 |
| InChI | InChI=1S/C20H19F3O5/c1-2-19(11-25-12-19)13-26-15-5-3-14(4-6-15)18(24)27-16-7-9-17(10-8-16)28-20(21,22)23/h3-10H,2,11-13H2,1H3 |
| InChIKey | DFXYILOVCAADFT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|