C27H33F3O6 — CID 59767499
[4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate (PubChem CID 59767499) has the molecular formula C27H33F3O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate |
|---|---|
| PubChem CID | 59767499 |
| Molecular Formula | C27H33F3O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[8-[(3-methyloxetan-3-yl)methoxy]octoxy]benzoate |
| SMILES | CC1(COCCCCCCCCOc2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)COC1 |
| InChI | InChI=1S/C27H33F3O6/c1-26(19-33-20-26)18-32-16-6-4-2-3-5-7-17-34-22-10-8-21(9-11-22)25(31)35-23-12-14-24(15-13-23)36-27(28,29)30/h8-15H,2-7,16-20H2,1H3 |
| InChIKey | YUWLXVSGYJXOGB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|